Name | L-Homophenylalanine hydrochloride |
Synonyms | L-Beta-homo-Phe.HCl L-Homophenylalanine HCl L-HOMOPHENYLALANINE HCL L-HOMOPHENYLALANINE HCL SALT L-Phenylalanine hydrochloride L-HOMOPHENYLALANINE HYDROCHLORIDE L-Homophenylalanine hydrochloride L- Homophenylalanine·HCl Salt (LHPA) (S)-2-AMino-4-phenylbutanoic acid hydrochloride (1S)-1-carboxy-3-phenylpropan-1-aminium chloride Amino-4-Phenylbutyric acid Hydrochloride, (S)-2- |
CAS | 105382-09-0 |
InChI | InChI=1/C10H13NO2.ClH/c11-9(10(12)13)7-6-8-4-2-1-3-5-8;/h1-5,9H,6-7,11H2,(H,12,13);1H/t9-;/m0./s1 |
Molecular Formula | C10H14ClNO2 |
Molar Mass | 215.68 |
Melting Point | 262-265°C (dec.)(lit.) |
Boling Point | 324.8°C at 760 mmHg |
Flash Point | 150.2°C |
Vapor Presure | 9.79E-05mmHg at 25°C |
Storage Condition | Sealed in dry,Room Temperature |
Use | It is an important intermediate for the synthesis of various drugs |
WGK Germany | 3 |
use | is an important intermediate for the synthesis of various pril drugs |